CAS 1329834-57-2 appears in our catalog under these names: Romifidine-d4 Hydrochloride, >95% (HPLC), Romifidine-d4 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
N-(2-bromo-6-fluorophenyl)-4,4,5,5-tetradeuterio-1H-imidazol-2-amine;hydrochloride (CAS 1329834-57-2) is a chemical compound with the molecular formula C9H10BrClFN3 and a molecular weight of 298.57 g/mol. IUPAC name: N-(2-bromo-6-fluorophenyl)-4,4,5,5-tetradeuterio-1H-imidazol-2-amine;hydrochloride. InChIKey: SDXVSIWCVTYYQN-HGFPCDIYSA-N.
| Molecular formula | C9H10BrClFN3 |
|---|---|
| Molecular weight | 298.57 g/mol |
| IUPAC name | N-(2-bromo-6-fluorophenyl)-4,4,5,5-tetradeuterio-1H-imidazol-2-amine;hydrochloride |
| InChIKey | SDXVSIWCVTYYQN-HGFPCDIYSA-N |
| SMILES | [2H]C1(C(N=C(N1)NC2=C(C=CC=C2Br)F)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)