Products 1329834-71-0
CAS 1329834-71-0 is the registry number for n-Dipropylamine-d4 Hydrochloride. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1,1-dideuterio-N-(1,1-dideuteriopropyl)propan-1-amine;hydrochloride (CAS 1329834-71-0) is a chemical compound with the molecular formula C6H16ClN and a molecular weight of 141.67 g/mol. IUPAC name: 1,1-dideuterio-N-(1,1-dideuteriopropyl)propan-1-amine;hydrochloride. InChIKey: GAZIBGHLWYHBDT-NXMSQKFDSA-N.
| Molecular formula | C6H16ClN |
|---|---|
| Molecular weight | 141.67 g/mol |
| IUPAC name | 1,1-dideuterio-N-(1,1-dideuteriopropyl)propan-1-amine;hydrochloride |
| InChIKey | GAZIBGHLWYHBDT-NXMSQKFDSA-N |
| SMILES | [2H]C([2H])(CC)NC([2H])([2H])CC.Cl |
Computed by PubChem (NCBI)
Synonyms:
n-Dipropylamine-d4 Hydrochloride