Products 1329835-51-9
CAS 1329835-51-9 appears in our catalog under these names: Ciclopirox Impurity 3(Ciclopirox EP Impurity C )-d11, N-Deshydroxy Ciclopirox-d11. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg.
4-methyl-6-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)-1H-pyridin-2-one (CAS 1329835-51-9) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 202.34 g/mol. IUPAC name: 4-methyl-6-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)-1H-pyridin-2-one. InChIKey: USGUFDUEIADEJP-WOHCQCBNSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 202.34 g/mol |
| IUPAC name | 4-methyl-6-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)-1H-pyridin-2-one |
| InChIKey | USGUFDUEIADEJP-WOHCQCBNSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C2=CC(=CC(=O)N2)C)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)