CAS 1329836-72-7 is the registry number for Pericyazine-d4. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
10-[3-(2,2,6,6-tetradeuterio-4-hydroxypiperidin-1-yl)propyl]phenothiazine-2-carbonitrile (CAS 1329836-72-7) is a chemical compound with the molecular formula C21H23N3OS and a molecular weight of 369.5 g/mol. IUPAC name: 10-[3-(2,2,6,6-tetradeuterio-4-hydroxypiperidin-1-yl)propyl]phenothiazine-2-carbonitrile. InChIKey: LUALIOATIOESLM-IDPVZSQYSA-N.
| Molecular formula | C21H23N3OS |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 10-[3-(2,2,6,6-tetradeuterio-4-hydroxypiperidin-1-yl)propyl]phenothiazine-2-carbonitrile |
| InChIKey | LUALIOATIOESLM-IDPVZSQYSA-N |
| SMILES | [2H]C1(CC(CC(N1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C#N)([2H])[2H])O)[2H] |
Computed by PubChem (NCBI)