Products 1329838-45-0
CAS 1329838-45-0 appears in our catalog under these names: Phenoxybenzamine-d5 HCl, Phenoxybenzamine-d5 Hydrochloride, Phenoxybenzamine–d5 (hydrochloride), Phenoxybenzamine-d5 (hydrochloride). Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 50mg, 1mg, 5mg, 10 mg, 1 mg.
N-benzyl-N-(2-chloroethyl)-1-(2,3,4,5,6-pentadeuteriophenoxy)propan-2-amine;hydrochloride (CAS 1329838-45-0) is a chemical compound with the molecular formula C18H23Cl2NO and a molecular weight of 345.3 g/mol. IUPAC name: N-benzyl-N-(2-chloroethyl)-1-(2,3,4,5,6-pentadeuteriophenoxy)propan-2-amine;hydrochloride. InChIKey: VBCPVIWPDJVHAN-PEEBBJRGSA-N.
| Molecular formula | C18H23Cl2NO |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | N-benzyl-N-(2-chloroethyl)-1-(2,3,4,5,6-pentadeuteriophenoxy)propan-2-amine;hydrochloride |
| InChIKey | VBCPVIWPDJVHAN-PEEBBJRGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OCC(C)N(CCCl)CC2=CC=CC=C2)[2H])[2H].Cl |
Computed by PubChem (NCBI)