CAS 133-15-3 appears in our catalog under these names: 4-Aminosalicylic acid calcium salt heptahydrate, 95%, 4-Aminosalicylic acid (hemicalcium). Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 500g, 100g, 5g, 25g, 1g, Get quote.
Calcium bis(5-amino-2-carboxyphenolate) (CAS 133-15-3) is a chemical compound with the molecular formula C14H12CaN2O6 and a molecular weight of 344.33 g/mol. IUPAC name: calcium bis(5-amino-2-carboxyphenolate). InChIKey: XDWVNCOPMIEDJK-UHFFFAOYSA-L.
| Molecular formula | C14H12CaN2O6 |
|---|---|
| Molecular weight | 344.33 g/mol |
| IUPAC name | calcium bis(5-amino-2-carboxyphenolate) |
| InChIKey | XDWVNCOPMIEDJK-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1N)[O-])C(=O)O.C1=CC(=C(C=C1N)[O-])C(=O)O.[Ca+2] |
Computed by PubChem (NCBI)