CAS 133-91-5 appears in our catalog under these names: Closantel EP Impurity A, 3,5-Diiodosalicylic Acid, >95% (HPLC), 3,5–Diiodosalicylic acid, 3,5-Diiodosalicylic acid, 97% , 3,5-Diiodosalicylic acid. Offered by: Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: on request, 100g, 25g, 500g, 0,25kg, 250g, 1000g, 5g.
2-hydroxy-3,5-diiodobenzoic acid (CAS 133-91-5) is a chemical compound with the molecular formula C7H4I2O3 and a molecular weight of 389.91 g/mol. IUPAC name: 2-hydroxy-3,5-diiodobenzoic acid. InChIKey: DHZVWQPHNWDCFS-UHFFFAOYSA-N.
| Molecular formula | C7H4I2O3 |
|---|---|
| Molecular weight | 389.91 g/mol |
| IUPAC name | 2-hydroxy-3,5-diiodobenzoic acid |
| InChIKey | DHZVWQPHNWDCFS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)I)I |
Computed by PubChem (NCBI)