CAS 1330003-04-7 appears in our catalog under these names: CZC-25146 hydrochloride/ 99.06% (existing batch purity), CZC-25146 hydrochloride, LRRK2 Inhibitor II, CZC-2514 1PC X 10MG, CZC-25146 hydrochloride, ≥98%, ≥98%, CZC-25146 (hydrochloride). Offered by: TargetMol, Biosynth, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
N-[2-[[5-fluoro-2-(2-methoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]methanesulfonamide;hydrochloride (CAS 1330003-04-7) is a chemical compound with the molecular formula C22H26ClFN6O4S and a molecular weight of 525.0 g/mol. IUPAC name: N-[2-[[5-fluoro-2-(2-methoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]methanesulfonamide;hydrochloride. InChIKey: SKYQTYQDKAOHLP-UHFFFAOYSA-N.
| Molecular formula | C22H26ClFN6O4S |
|---|---|
| Molecular weight | 525.0 g/mol |
| IUPAC name | N-[2-[[5-fluoro-2-(2-methoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]methanesulfonamide;hydrochloride |
| InChIKey | SKYQTYQDKAOHLP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCOCC2)NC3=NC=C(C(=N3)NC4=CC=CC=C4NS(=O)(=O)C)F.Cl |
Computed by PubChem (NCBI)