CAS 1330052-70-4 appears in our catalog under these names: 4-Ethyl-2-pyridinecarbonitrile-d5, 4-Ethylpyridine-2-carbonitrile-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
3,5,6-trideuterio-4-(1,1-dideuterioethyl)pyridine-2-carbonitrile (CAS 1330052-70-4) is a chemical compound with the molecular formula C8H8N2 and a molecular weight of 137.19 g/mol. IUPAC name: 3,5,6-trideuterio-4-(1,1-dideuterioethyl)pyridine-2-carbonitrile. InChIKey: WSIWRNNXMDBVGX-SIPVGYFWSA-N.
| Molecular formula | C8H8N2 |
|---|---|
| Molecular weight | 137.19 g/mol |
| IUPAC name | 3,5,6-trideuterio-4-(1,1-dideuterioethyl)pyridine-2-carbonitrile |
| InChIKey | WSIWRNNXMDBVGX-SIPVGYFWSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1C([2H])([2H])C)[2H])C#N)[2H] |
Computed by PubChem (NCBI)