Products 13301-33-2
CAS 13301-33-2 is the registry number for C.I. Mordant green 17. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-amino-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid (CAS 13301-33-2) is a chemical compound with the molecular formula C16H12N4O10S2 and a molecular weight of 484.4 g/mol. IUPAC name: 5-amino-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid. InChIKey: ZZDLYKYIGJOAOW-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O10S2 |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | 5-amino-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| InChIKey | ZZDLYKYIGJOAOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N=NC2=C(C3=C(C=C(C=C3C=C2S(=O)(=O)O)S(=O)(=O)O)N)O)O |
Computed by PubChem (NCBI)