CAS 1330128-70-5 is the registry number for (S)-4-(1-(Methylsulfonamido)-1-oxopropan-2-yl)phenyl trifluoromethanesulfonate, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
[4-[(2S)-1-(methanesulfonamido)-1-oxopropan-2-yl]phenyl] trifluoromethanesulfonate (CAS 1330128-70-5) is a chemical compound with the molecular formula C11H12F3NO6S2 and a molecular weight of 375.3 g/mol. IUPAC name: [4-[(2S)-1-(methanesulfonamido)-1-oxopropan-2-yl]phenyl] trifluoromethanesulfonate. InChIKey: DDLPYOCJHQSVSZ-ZETCQYMHSA-N.
| Molecular formula | C11H12F3NO6S2 |
|---|---|
| Molecular weight | 375.3 g/mol |
| IUPAC name | [4-[(2S)-1-(methanesulfonamido)-1-oxopropan-2-yl]phenyl] trifluoromethanesulfonate |
| InChIKey | DDLPYOCJHQSVSZ-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OS(=O)(=O)C(F)(F)F)C(=O)NS(=O)(=O)C |
Computed by PubChem (NCBI)