CAS 1330165-30-4 is the registry number for Malonamide-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(1,2,3-13C3)propanediamide (CAS 1330165-30-4) is a chemical compound with the molecular formula C3H6N2O2 and a molecular weight of 105.070 g/mol. IUPAC name: (1,2,3-13C3)propanediamide. InChIKey: WRIRWRKPLXCTFD-VMIGTVKRSA-N.
| Molecular formula | C3H6N2O2 |
|---|---|
| Molecular weight | 105.070 g/mol |
| IUPAC name | (1,2,3-13C3)propanediamide |
| InChIKey | WRIRWRKPLXCTFD-VMIGTVKRSA-N |
| SMILES | [13CH2]([13C](=O)N)[13C](=O)N |
Computed by PubChem (NCBI)