Products 1330165-30-4

CAS 1330165-30-4 is the registry number for Malonamide-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.

Structural formula: {0} (CAS {1})

(1,2,3-13C3)propanediamide (CAS 1330165-30-4) is a chemical compound with the molecular formula C3H6N2O2 and a molecular weight of 105.070 g/mol. IUPAC name: (1,2,3-13C3)propanediamide. InChIKey: WRIRWRKPLXCTFD-VMIGTVKRSA-N.

Identity
Molecular formulaC3H6N2O2
Molecular weight105.070 g/mol
IUPAC name(1,2,3-13C3)propanediamide
InChIKeyWRIRWRKPLXCTFD-VMIGTVKRSA-N
SMILES[13CH2]([13C](=O)N)[13C](=O)N

Computed by PubChem (NCBI)

Synonyms: Malonamide-13C3