CAS 1330166-69-2 is the registry number for 5-Silaspiro(4.5)decan-8-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
5-silaspiro[4.5]decan-8-amine;hydrochloride (CAS 1330166-69-2) is a chemical compound with the molecular formula C9H20ClNSi and a molecular weight of 205.80 g/mol. IUPAC name: 5-silaspiro[4.5]decan-8-amine;hydrochloride. InChIKey: UBVCIKNYSKXKPX-UHFFFAOYSA-N.
| Molecular formula | C9H20ClNSi |
|---|---|
| Molecular weight | 205.80 g/mol |
| IUPAC name | 5-silaspiro[4.5]decan-8-amine;hydrochloride |
| InChIKey | UBVCIKNYSKXKPX-UHFFFAOYSA-N |
| SMILES | C1CC[Si]2(C1)CCC(CC2)N.Cl |
Computed by PubChem (NCBI)