Products 1330170-43-8
CAS 1330170-43-8 is the registry number for Rac-(1r,6s)-3-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 100mg, 1g.
(1S,6R)-3-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one (CAS 1330170-43-8) is a chemical compound with the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. IUPAC name: (1S,6R)-3-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one. InChIKey: QKAKLAFGBZQMLX-RQJHMYQMSA-N.
| Molecular formula | C8H14N2O |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | (1S,6R)-3-methyl-3,9-diazabicyclo[4.2.1]nonan-4-one |
| InChIKey | QKAKLAFGBZQMLX-RQJHMYQMSA-N |
| SMILES | CN1C[C@@H]2CC[C@@H](N2)CC1=O |
Computed by PubChem (NCBI)