CAS 1330171-28-2 appears in our catalog under these names: Sulfoxymethyl-Furfural Sodium Salt, 5-Sulfooxymethylfurfural Sodium Salt, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
Sodium (5-formylfuran-2-yl)methyl sulfate (CAS 1330171-28-2) is a chemical compound with the molecular formula C6H5NaO6S and a molecular weight of 228.16 g/mol. IUPAC name: sodium (5-formylfuran-2-yl)methyl sulfate. InChIKey: KTRGQDPJPVHDGB-UHFFFAOYSA-M.
| Molecular formula | C6H5NaO6S |
|---|---|
| Molecular weight | 228.16 g/mol |
| IUPAC name | sodium (5-formylfuran-2-yl)methyl sulfate |
| InChIKey | KTRGQDPJPVHDGB-UHFFFAOYSA-M |
| SMILES | C1=C(OC(=C1)C=O)COS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)