CAS 1330171-61-3 appears in our catalog under these names: rac-Vigabatrin-13C,d2 (Major), >95% (HPLC), Rac-Vigabatrin-13C,d2 (Major). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-amino-6,6-dideuterio(613C)hex-5-enoic acid (CAS 1330171-61-3) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 132.16 g/mol. IUPAC name: 4-amino-6,6-dideuterio(613C)hex-5-enoic acid. InChIKey: PJDFLNIOAUIZSL-WGVGGRBOSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 132.16 g/mol |
| IUPAC name | 4-amino-6,6-dideuterio(613C)hex-5-enoic acid |
| InChIKey | PJDFLNIOAUIZSL-WGVGGRBOSA-N |
| SMILES | [2H][13C](=CC(CCC(=O)O)N)[2H] |
Computed by PubChem (NCBI)