CAS 1330173-19-7 appears in our catalog under these names: rac N-Demethyl Promethazine-d3 Hydrochloride, N-Demethyl Promethazine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
1-phenothiazin-10-yl-N-(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 1330173-19-7) is a chemical compound with the molecular formula C16H19ClN2S and a molecular weight of 309.9 g/mol. IUPAC name: 1-phenothiazin-10-yl-N-(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: DJGGTRGRXVNMMY-MUTAZJQDSA-N.
| Molecular formula | C16H19ClN2S |
|---|---|
| Molecular weight | 309.9 g/mol |
| IUPAC name | 1-phenothiazin-10-yl-N-(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | DJGGTRGRXVNMMY-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)CN1C2=CC=CC=C2SC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)