CAS 1330180-56-7 appears in our catalog under these names: N-Nitrosopiperazine-d8, >95% (GC), 1-Nitrosopiperazine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
2,2,3,3,5,5,6,6-octadeuterio-1-nitrosopiperazine (CAS 1330180-56-7) is a chemical compound with the molecular formula C4H9N3O and a molecular weight of 123.18 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-nitrosopiperazine. InChIKey: CVTIZMOISGMZRJ-SVYQBANQSA-N.
| Molecular formula | C4H9N3O |
|---|---|
| Molecular weight | 123.18 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-nitrosopiperazine |
| InChIKey | CVTIZMOISGMZRJ-SVYQBANQSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])N=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)