CAS 1330180-76-1 appears in our catalog under these names: 6-Hydroxy Bentazon-d7, >95% (HPLC), 6-Hydroxy Bentazon-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 10 mg, 5 mg.
3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-hydroxy-2,2-dioxo-1H-2lambda6,1,3-benzothiadiazin-4-one (CAS 1330180-76-1) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 263.32 g/mol. IUPAC name: 3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-hydroxy-2,2-dioxo-1H-2lambda6,1,3-benzothiadiazin-4-one. InChIKey: PVKWIOBXPPFARA-NWOXSKRJSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 263.32 g/mol |
| IUPAC name | 3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-hydroxy-2,2-dioxo-1H-2lambda6,1,3-benzothiadiazin-4-one |
| InChIKey | PVKWIOBXPPFARA-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N1C(=O)C2=C(C=CC(=C2)O)NS1(=O)=O |
Computed by PubChem (NCBI)