CAS 1330184-85-4 appears in our catalog under these names: 2,2,3,3-Tetrafluoropropyl triethylammonium triflate, 95%, N,N,N–triethyl–2,2,3,3–tetrafluoropropan–1–aminium trifluoromethanesulfonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g.
Triethyl(2,2,3,3-tetrafluoropropyl)azanium;trifluoromethanesulfonate (CAS 1330184-85-4) is a chemical compound with the molecular formula C10H18F7NO3S and a molecular weight of 365.31 g/mol. IUPAC name: triethyl(2,2,3,3-tetrafluoropropyl)azanium;trifluoromethanesulfonate. InChIKey: LBLGOBSMJLBDLB-UHFFFAOYSA-M.
| Molecular formula | C10H18F7NO3S |
|---|---|
| Molecular weight | 365.31 g/mol |
| IUPAC name | triethyl(2,2,3,3-tetrafluoropropyl)azanium;trifluoromethanesulfonate |
| InChIKey | LBLGOBSMJLBDLB-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC(C(F)F)(F)F.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)