Products 1330261-08-9
CAS 1330261-08-9 is the registry number for CP-47497-d5. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 5mg, 1mg.
5-(2-methyloctan-2-yl)-2-[(1S)-2,2,3,4,4-pentadeuterio-3-hydroxycyclohexyl]phenol (CAS 1330261-08-9) is a chemical compound with the molecular formula C21H34O2 and a molecular weight of 323.5 g/mol. IUPAC name: 5-(2-methyloctan-2-yl)-2-[(1S)-2,2,3,4,4-pentadeuterio-3-hydroxycyclohexyl]phenol. InChIKey: ZWWRREXSUJTKNN-BDMCVSKBSA-N.
| Molecular formula | C21H34O2 |
|---|---|
| Molecular weight | 323.5 g/mol |
| IUPAC name | 5-(2-methyloctan-2-yl)-2-[(1S)-2,2,3,4,4-pentadeuterio-3-hydroxycyclohexyl]phenol |
| InChIKey | ZWWRREXSUJTKNN-BDMCVSKBSA-N |
| SMILES | [2H]C1(CC[C@@H](C(C1([2H])O)([2H])[2H])C2=C(C=C(C=C2)C(C)(C)CCCCCC)O)[2H] |
Computed by PubChem (NCBI)