CAS 1330265-87-6 is the registry number for N,N’-Diacetyl DAMPA Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 1mg.
Ethyl 4-[(2,4-diacetamidopteridin-6-yl)methyl-methylamino]benzoate (CAS 1330265-87-6) is a chemical compound with the molecular formula C21H23N7O4 and a molecular weight of 437.5 g/mol. IUPAC name: ethyl 4-[(2,4-diacetamidopteridin-6-yl)methyl-methylamino]benzoate. InChIKey: IDLWDJJUFDRRHX-UHFFFAOYSA-N.
| Molecular formula | C21H23N7O4 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | ethyl 4-[(2,4-diacetamidopteridin-6-yl)methyl-methylamino]benzoate |
| InChIKey | IDLWDJJUFDRRHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N(C)CC2=CN=C3C(=N2)C(=NC(=N3)NC(=O)C)NC(=O)C |
Computed by PubChem (NCBI)