Products 1330265-87-6

CAS 1330265-87-6 is the registry number for N,N’-Diacetyl DAMPA Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

Ethyl 4-[(2,4-diacetamidopteridin-6-yl)methyl-methylamino]benzoate (CAS 1330265-87-6) is a chemical compound with the molecular formula C21H23N7O4 and a molecular weight of 437.5 g/mol. IUPAC name: ethyl 4-[(2,4-diacetamidopteridin-6-yl)methyl-methylamino]benzoate. InChIKey: IDLWDJJUFDRRHX-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23N7O4
Molecular weight437.5 g/mol
IUPAC nameethyl 4-[(2,4-diacetamidopteridin-6-yl)methyl-methylamino]benzoate
InChIKeyIDLWDJJUFDRRHX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)N(C)CC2=CN=C3C(=N2)C(=NC(=N3)NC(=O)C)NC(=O)C

Computed by PubChem (NCBI)