CAS 1330277-32-1 appears in our catalog under these names: 3-(Methylnitrosamino)propanal-d5, N-Methyl-N-(3-oxopropyl)nitrous amide-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
N-(1,1-dideuterio-3-oxopropyl)-N-(trideuteriomethyl)nitrous amide (CAS 1330277-32-1) is a chemical compound with the molecular formula C4H8N2O2 and a molecular weight of 121.15 g/mol. IUPAC name: N-(1,1-dideuterio-3-oxopropyl)-N-(trideuteriomethyl)nitrous amide. InChIKey: CQGSPCLZUXSVHE-WNWXXORZSA-N.
| Molecular formula | C4H8N2O2 |
|---|---|
| Molecular weight | 121.15 g/mol |
| IUPAC name | N-(1,1-dideuterio-3-oxopropyl)-N-(trideuteriomethyl)nitrous amide |
| InChIKey | CQGSPCLZUXSVHE-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])N(C([2H])([2H])CC=O)N=O |
Computed by PubChem (NCBI)