CAS 133054-10-1 is the registry number for 2,5-Dioxopyrrolidin-1-yl ((benzyloxy)carbonyl)-D-tryptophanate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,5-dioxopyrrolidin-1-yl) (2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 133054-10-1) is a chemical compound with the molecular formula C23H21N3O6 and a molecular weight of 435.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: PLMKYGHASWACNG-LJQANCHMSA-N.
| Molecular formula | C23H21N3O6 |
|---|---|
| Molecular weight | 435.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | PLMKYGHASWACNG-LJQANCHMSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)[C@@H](CC2=CNC3=CC=CC=C32)NC(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)