Products 133066-53-2
CAS 133066-53-2 appears in our catalog under these names: H–Lys–Pro–AMC, Lys-Pro-AMC. Offered by: GLPBio, MedChemExpress. Available pack sizes: 250mg, 50mg, Get quote.
(2S)-1-[(2S)-2,6-diaminohexanoyl]-N-(4-methyl-2-oxochromen-7-yl)pyrrolidine-2-carboxamide (CAS 133066-53-2) is a chemical compound with the molecular formula C21H28N4O4 and a molecular weight of 400.5 g/mol. IUPAC name: (2S)-1-[(2S)-2,6-diaminohexanoyl]-N-(4-methyl-2-oxochromen-7-yl)pyrrolidine-2-carboxamide. InChIKey: NSYORZKUSRQUFF-IRXDYDNUSA-N.
| Molecular formula | C21H28N4O4 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | (2S)-1-[(2S)-2,6-diaminohexanoyl]-N-(4-methyl-2-oxochromen-7-yl)pyrrolidine-2-carboxamide |
| InChIKey | NSYORZKUSRQUFF-IRXDYDNUSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@@H]3CCCN3C(=O)[C@H](CCCCN)N |
Computed by PubChem (NCBI)