CAS 133071-57-5 is the registry number for 3-({4-[(5-Methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl}carbamoyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-4-oxobutanoic acid (CAS 133071-57-5) is a chemical compound with the molecular formula C14H15N3O6S and a molecular weight of 353.35 g/mol. IUPAC name: 4-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-4-oxobutanoic acid. InChIKey: ZXGQNVUADFSGGQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O6S |
|---|---|
| Molecular weight | 353.35 g/mol |
| IUPAC name | 4-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-4-oxobutanoic acid |
| InChIKey | ZXGQNVUADFSGGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)