CAS 1330765-30-4 appears in our catalog under these names: tert-Butyl 7-bromo-5-oxa-2-azaspiro[3.4]octane-2-carboxylate, 95%, tert–Butyl 7–bromo–5–oxa–2–azaspiro(3·4)octane–2–carboxylate, Tert-Butyl 7-Bromo-5-Oxa-2-Azaspiro(3.4)Octane-2-Carboxylate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
Tert-butyl 7-bromo-5-oxa-2-azaspiro[3.4]octane-2-carboxylate (CAS 1330765-30-4) is a chemical compound with the molecular formula C11H18BrNO3 and a molecular weight of 292.17 g/mol. IUPAC name: tert-butyl 7-bromo-5-oxa-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: BFMNMRHGKNUVSC-UHFFFAOYSA-N.
| Molecular formula | C11H18BrNO3 |
|---|---|
| Molecular weight | 292.17 g/mol |
| IUPAC name | tert-butyl 7-bromo-5-oxa-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | BFMNMRHGKNUVSC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(CO2)Br |
Computed by PubChem (NCBI)