CAS 133083-34-8 is the registry number for (R,S)-Fmoc-2-amino-3-(7-methoxy-4-coumaryl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(7-methoxy-2-oxochromen-4-yl)propanoic acid (CAS 133083-34-8) is a chemical compound with the molecular formula C28H23NO7 and a molecular weight of 485.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(7-methoxy-2-oxochromen-4-yl)propanoic acid. InChIKey: UMTJSVFQWCDZCB-UHFFFAOYSA-N.
| Molecular formula | C28H23NO7 |
|---|---|
| Molecular weight | 485.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(7-methoxy-2-oxochromen-4-yl)propanoic acid |
| InChIKey | UMTJSVFQWCDZCB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=O)O2)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)