CAS 133099-10-2 is the registry number for (R)-2,2-Diphenyl-2-(1-tosylpyrrolidin-3-yl)acetonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-2,2-diphenylacetonitrile (CAS 133099-10-2) is a chemical compound with the molecular formula C25H24N2O2S and a molecular weight of 416.5 g/mol. IUPAC name: 2-[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-2,2-diphenylacetonitrile. InChIKey: XPQZNOFTICUMIN-QHCPKHFHSA-N.
| Molecular formula | C25H24N2O2S |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 2-[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-2,2-diphenylacetonitrile |
| InChIKey | XPQZNOFTICUMIN-QHCPKHFHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC[C@@H](C2)C(C#N)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)