Products 133117-45-0
CAS 133117-45-0 is the registry number for (2-Chloro-6-fluorophenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-chloro-6-fluorophenyl)-trimethylsilane (CAS 133117-45-0) is a chemical compound with the molecular formula C9H12ClFSi and a molecular weight of 202.73 g/mol. IUPAC name: (2-chloro-6-fluorophenyl)-trimethylsilane. InChIKey: DBTQHCATZLMPLH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClFSi |
|---|---|
| Molecular weight | 202.73 g/mol |
| IUPAC name | (2-chloro-6-fluorophenyl)-trimethylsilane |
| InChIKey | DBTQHCATZLMPLH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC=C1Cl)F |
Computed by PubChem (NCBI)