CAS 133132-74-8 is the registry number for 4-Chloro-3-methyl-2,2-diphenylbutyronitrile. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
4-chloro-3-methyl-2,2-diphenylbutanenitrile (CAS 133132-74-8) is a chemical compound with the molecular formula C17H16ClN and a molecular weight of 269.8 g/mol. IUPAC name: 4-chloro-3-methyl-2,2-diphenylbutanenitrile. InChIKey: PEHXKUSWSJTMRC-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN |
|---|---|
| Molecular weight | 269.8 g/mol |
| IUPAC name | 4-chloro-3-methyl-2,2-diphenylbutanenitrile |
| InChIKey | PEHXKUSWSJTMRC-UHFFFAOYSA-N |
| SMILES | CC(CCl)C(C#N)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)