CAS 1331636-39-5 appears in our catalog under these names: rac-2-Linoleoyl-3-chloropropanediol-d5, 95%, rac-2-Linoleoyl-3-chloropropanediol-d5,95%. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
(1-chloro-1,1,2,3,3-pentadeuterio-3-hydroxypropan-2-yl) (9Z,12Z)-octadeca-9,12-dienoate (CAS 1331636-39-5) is a chemical compound with the molecular formula C21H37ClO3 and a molecular weight of 378.0 g/mol. IUPAC name: (1-chloro-1,1,2,3,3-pentadeuterio-3-hydroxypropan-2-yl) (9Z,12Z)-octadeca-9,12-dienoate. InChIKey: XXIZTUQKOFRDML-HRFNPRCSSA-N.
| Molecular formula | C21H37ClO3 |
|---|---|
| Molecular weight | 378.0 g/mol |
| IUPAC name | (1-chloro-1,1,2,3,3-pentadeuterio-3-hydroxypropan-2-yl) (9Z,12Z)-octadeca-9,12-dienoate |
| InChIKey | XXIZTUQKOFRDML-HRFNPRCSSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Cl)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)O |
Computed by PubChem (NCBI)