CAS 1331637-53-6 is the registry number for N-Methyl-1-(methylthio)-2-nitroethenamine-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
1-methylsulfanyl-2-nitro-N-(trideuteriomethyl)ethenamine (CAS 1331637-53-6) is a chemical compound with the molecular formula C4H8N2O2S and a molecular weight of 151.20 g/mol. IUPAC name: 1-methylsulfanyl-2-nitro-N-(trideuteriomethyl)ethenamine. InChIKey: YQFHPXZGXNYYLD-FIBGUPNXSA-N.
| Molecular formula | C4H8N2O2S |
|---|---|
| Molecular weight | 151.20 g/mol |
| IUPAC name | 1-methylsulfanyl-2-nitro-N-(trideuteriomethyl)ethenamine |
| InChIKey | YQFHPXZGXNYYLD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC(=C[N+](=O)[O-])SC |
Computed by PubChem (NCBI)