CAS 1331643-02-7 is the registry number for S,N,N'-Trimethylisothiouronium-d9 Iodide. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Trideuteriomethyl N,N'-bis(trideuteriomethyl)carbamimidothioate;hydroiodide (CAS 1331643-02-7) is a chemical compound with the molecular formula C4H11IN2S and a molecular weight of 255.17 g/mol. IUPAC name: trideuteriomethyl N,N'-bis(trideuteriomethyl)carbamimidothioate;hydroiodide. InChIKey: VAKZYIIFXHRFIA-KYRNGWDOSA-N.
| Molecular formula | C4H11IN2S |
|---|---|
| Molecular weight | 255.17 g/mol |
| IUPAC name | trideuteriomethyl N,N'-bis(trideuteriomethyl)carbamimidothioate;hydroiodide |
| InChIKey | VAKZYIIFXHRFIA-KYRNGWDOSA-N |
| SMILES | [2H]C([2H])([2H])NC(=NC([2H])([2H])[2H])SC([2H])([2H])[2H].I |
Computed by PubChem (NCBI)