Products 1331643-32-3
CAS 1331643-32-3 appears in our catalog under these names: (E/Z)-N,N-Didesmethyl-4-hydroxy Tamoxifen 2’-Azide, >95% (HPLC), (E/Z)-N,N-Didesmethyl-4-hydroxy tamoxifen 2’-azide. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 10mg, 50mg.
4-[(Z)-1-[4-(2-azidoethoxy)phenyl]-2-phenylbut-1-enyl]phenol (CAS 1331643-32-3) is a chemical compound with the molecular formula C24H23N3O2 and a molecular weight of 385.5 g/mol. IUPAC name: 4-[(Z)-1-[4-(2-azidoethoxy)phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: BCHPNTIJLIFVLF-VHXPQNKSSA-N.
| Molecular formula | C24H23N3O2 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | 4-[(Z)-1-[4-(2-azidoethoxy)phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | BCHPNTIJLIFVLF-VHXPQNKSSA-N |
| SMILES | CC/C(=C(\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)OCCN=[N+]=[N-])/C3=CC=CC=C3 |
Computed by PubChem (NCBI)