CAS 1331888-08-4 appears in our catalog under these names: NG, NG’-Dimethyl-L-Arginine-d6, NG,NG’-Dimethyl-L-arginine-D6, >95% (HPLC), N,N'-Dimethylarginine-d6, SDMA–d6, SDMA-d6, 98.07%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 1 mg.
(2S)-2-amino-5-[[N,N'-bis(trideuteriomethyl)carbamimidoyl]amino]pentanoic acid (CAS 1331888-08-4) is a chemical compound with the molecular formula C8H18N4O2 and a molecular weight of 208.29 g/mol. IUPAC name: (2S)-2-amino-5-[[N,N'-bis(trideuteriomethyl)carbamimidoyl]amino]pentanoic acid. InChIKey: HVPFXCBJHIIJGS-BGUMHVNPSA-N.
| Molecular formula | C8H18N4O2 |
|---|---|
| Molecular weight | 208.29 g/mol |
| IUPAC name | (2S)-2-amino-5-[[N,N'-bis(trideuteriomethyl)carbamimidoyl]amino]pentanoic acid |
| InChIKey | HVPFXCBJHIIJGS-BGUMHVNPSA-N |
| SMILES | [2H]C([2H])([2H])NC(=NC([2H])([2H])[2H])NCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)