CAS 1331907-56-2 is the registry number for S-Methyl-L-cysteine-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2R)-2-amino-3-(trideuteriomethylsulfanyl)propanoic acid (CAS 1331907-56-2) is a chemical compound with the molecular formula C4H9NO2S and a molecular weight of 138.21 g/mol. IUPAC name: (2R)-2-amino-3-(trideuteriomethylsulfanyl)propanoic acid. InChIKey: IDIDJDIHTAOVLG-SRQSVDBESA-N.
| Molecular formula | C4H9NO2S |
|---|---|
| Molecular weight | 138.21 g/mol |
| IUPAC name | (2R)-2-amino-3-(trideuteriomethylsulfanyl)propanoic acid |
| InChIKey | IDIDJDIHTAOVLG-SRQSVDBESA-N |
| SMILES | [2H]C([2H])([2H])SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)