Products 1331918-65-0
CAS 1331918-65-0 is the registry number for NerveGreen C3. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[(E)-2-[4-(dipropylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-trimethylazanium dibromide (CAS 1331918-65-0) is a chemical compound with the molecular formula C25H39Br2N3 and a molecular weight of 541.4 g/mol. IUPAC name: 3-[4-[(E)-2-[4-(dipropylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-trimethylazanium dibromide. InChIKey: NERAMHAXFDMMRC-UHFFFAOYSA-L.
| Molecular formula | C25H39Br2N3 |
|---|---|
| Molecular weight | 541.4 g/mol |
| IUPAC name | 3-[4-[(E)-2-[4-(dipropylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-trimethylazanium dibromide |
| InChIKey | NERAMHAXFDMMRC-UHFFFAOYSA-L |
| SMILES | CCCN(CCC)C1=CC=C(C=C1)/C=C/C2=CC=[N+](C=C2)CCC[N+](C)(C)C.[Br-].[Br-] |
Computed by PubChem (NCBI)
Synonyms:
NerveGreen C3, orb2565691