CAS 133220-91-4 is the registry number for F 2692. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-6-methyl-1-[4-(trifluoromethyl)phenyl]pyridazin-4-one (CAS 133220-91-4) is a chemical compound with the molecular formula C12H10F3N3O and a molecular weight of 269.22 g/mol. IUPAC name: 3-amino-6-methyl-1-[4-(trifluoromethyl)phenyl]pyridazin-4-one. InChIKey: ZMXWZUGKYKOMHQ-UHFFFAOYSA-N.
| Molecular formula | C12H10F3N3O |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | 3-amino-6-methyl-1-[4-(trifluoromethyl)phenyl]pyridazin-4-one |
| InChIKey | ZMXWZUGKYKOMHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=NN1C2=CC=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)