CAS 1332301-04-8 is the registry number for 3-[(3-Chlorophenoxy)methyl]azetidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[(3-chlorophenoxy)methyl]azetidine (CAS 1332301-04-8) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 3-[(3-chlorophenoxy)methyl]azetidine. InChIKey: BMOSSYSSPAHIQB-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 3-[(3-chlorophenoxy)methyl]azetidine |
| InChIKey | BMOSSYSSPAHIQB-UHFFFAOYSA-N |
| SMILES | C1C(CN1)COC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)