Products 1332452-80-8
CAS 1332452-80-8 appears in our catalog under these names: 1-(tert-butyl)-2-naphthoic acid, 95%, 1-(1,1-Dimethylethyl)-2-naphthalenecarboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-tert-butylnaphthalene-2-carboxylic acid (CAS 1332452-80-8) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: 1-tert-butylnaphthalene-2-carboxylic acid. InChIKey: XEJYVKVZOAQEOJ-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 1-tert-butylnaphthalene-2-carboxylic acid |
| InChIKey | XEJYVKVZOAQEOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)