Products 1332530-13-8

CAS 1332530-13-8 is the registry number for Methyl 3-(1-benzyl-4-morpholin-4-ylpiperidin-3-yl)propanoate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Methyl 3-(1-benzyl-4-morpholin-4-ylpiperidin-3-yl)propanoate;oxalic acid (CAS 1332530-13-8) is a chemical compound with the molecular formula C22H32N2O7 and a molecular weight of 436.5 g/mol. IUPAC name: methyl 3-(1-benzyl-4-morpholin-4-ylpiperidin-3-yl)propanoate;oxalic acid. InChIKey: RJQPTYQAKNLOCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H32N2O7
Molecular weight436.5 g/mol
IUPAC namemethyl 3-(1-benzyl-4-morpholin-4-ylpiperidin-3-yl)propanoate;oxalic acid
InChIKeyRJQPTYQAKNLOCJ-UHFFFAOYSA-N
SMILESCOC(=O)CCC1CN(CCC1N2CCOCC2)CC3=CC=CC=C3.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)