CAS 1332530-67-2 appears in our catalog under these names: 1-(1-Adamantyl)-4-methyl-1,2,3,6-tetrahydropyridine hydrochloride, 95%, Pyridine, 1,2,3,6-tetrahydro-4-methyl-1-tricyclo[3.3.1.13,7]dec-1-yl-, hydrochloride (1:1), 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
1-(1-adamantyl)-4-methyl-3,6-dihydro-2H-pyridine;hydrochloride (CAS 1332530-67-2) is a chemical compound with the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. IUPAC name: 1-(1-adamantyl)-4-methyl-3,6-dihydro-2H-pyridine;hydrochloride. InChIKey: ODJYZUHPLYGQKV-UHFFFAOYSA-N.
| Molecular formula | C16H26ClN |
|---|---|
| Molecular weight | 267.84 g/mol |
| IUPAC name | 1-(1-adamantyl)-4-methyl-3,6-dihydro-2H-pyridine;hydrochloride |
| InChIKey | ODJYZUHPLYGQKV-UHFFFAOYSA-N |
| SMILES | CC1=CCN(CC1)C23CC4CC(C2)CC(C4)C3.Cl |
Computed by PubChem (NCBI)