CAS 1332531-62-0 is the registry number for Sodium 2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
Sodium 2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-4-carboxylate (CAS 1332531-62-0) is a chemical compound with the molecular formula C9H11N2NaO2S and a molecular weight of 234.25 g/mol. IUPAC name: sodium 2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-4-carboxylate. InChIKey: WZUNHZBKVSZLOY-UHFFFAOYSA-M.
| Molecular formula | C9H11N2NaO2S |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | sodium 2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-4-carboxylate |
| InChIKey | WZUNHZBKVSZLOY-UHFFFAOYSA-M |
| SMILES | C1CCN(C1)CC2=NC(=CS2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)