CAS 1332589-49-7 is the registry number for 3-Bromo-2-dichloromethyl-8-methyl-imidazo[1,2-a]pyridine HBr, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-bromo-2-(dichloromethyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide (CAS 1332589-49-7) is a chemical compound with the molecular formula C9H8Br2Cl2N2 and a molecular weight of 374.88 g/mol. IUPAC name: 3-bromo-2-(dichloromethyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide. InChIKey: PKTZPIUPTZJCCH-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2Cl2N2 |
|---|---|
| Molecular weight | 374.88 g/mol |
| IUPAC name | 3-bromo-2-(dichloromethyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide |
| InChIKey | PKTZPIUPTZJCCH-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2Br)C(Cl)Cl.Br |
Computed by PubChem (NCBI)