Products 1332692-49-5

CAS 1332692-49-5 is the registry number for Tirofiban Impurity 67. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2S)-2-(pentylsulfonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid (CAS 1332692-49-5) is a chemical compound with the molecular formula C23H38N2O5S and a molecular weight of 454.6 g/mol. IUPAC name: (2S)-2-(pentylsulfonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid. InChIKey: PJGXTLMUDGYCPG-QFIPXVFZSA-N.

Identity
Molecular formulaC23H38N2O5S
Molecular weight454.6 g/mol
IUPAC name(2S)-2-(pentylsulfonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid
InChIKeyPJGXTLMUDGYCPG-QFIPXVFZSA-N
SMILESCCCCCS(=O)(=O)N[C@@H](CC1=CC=C(C=C1)OCCCCC2CCNCC2)C(=O)O

Computed by PubChem (NCBI)