CAS 1332724-04-5 is the registry number for rac Desfluoro Citalopram Hydrobromide. Offered by: TRC. Available pack sizes: 25mg.
(1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;hydrobromide (CAS 1332724-04-5) is a chemical compound with the molecular formula C20H23BrN2O and a molecular weight of 387.3 g/mol. IUPAC name: (1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;hydrobromide. InChIKey: JWJCOJSCDWGPRN-BDQAORGHSA-N.
| Molecular formula | C20H23BrN2O |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | (1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;hydrobromide |
| InChIKey | JWJCOJSCDWGPRN-BDQAORGHSA-N |
| SMILES | CN(C)CCC[C@@]1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=CC=C3.Br |
Computed by PubChem (NCBI)