CAS 1332724-08-9 is the registry number for 5-Chlorodescyano Citalopram Hydrobromide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
3-[5-chloro-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine;hydrobromide (CAS 1332724-08-9) is a chemical compound with the molecular formula C19H22BrClFNO and a molecular weight of 414.7 g/mol. IUPAC name: 3-[5-chloro-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine;hydrobromide. InChIKey: XLWZQMAPPMWBPI-UHFFFAOYSA-N.
| Molecular formula | C19H22BrClFNO |
|---|---|
| Molecular weight | 414.7 g/mol |
| IUPAC name | 3-[5-chloro-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine;hydrobromide |
| InChIKey | XLWZQMAPPMWBPI-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)Cl)C3=CC=C(C=C3)F.Br |
Computed by PubChem (NCBI)