CAS 133307-04-7 is the registry number for 2-Bromo-1-nitro-3,5-bis(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-nitro-3,5-bis(trifluoromethyl)benzene (CAS 133307-04-7) is a chemical compound with the molecular formula C8H2BrF6NO2 and a molecular weight of 338.00 g/mol. IUPAC name: 2-bromo-1-nitro-3,5-bis(trifluoromethyl)benzene. InChIKey: GUVIMILYYYKCDW-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF6NO2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 2-bromo-1-nitro-3,5-bis(trifluoromethyl)benzene |
| InChIKey | GUVIMILYYYKCDW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Br)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)