CAS 1333218-50-0 appears in our catalog under these names: (S)-2-Amino-3-(3-(3-chloro-2-methyl-5-sulfophenyl)ureido)propanoic acid, 95%, Upacicalcet/ 98.57% (existing batch purity), Upacicalcet. Offered by: Chemat Brand, TargetMol, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2S)-2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid (CAS 1333218-50-0) is a chemical compound with the molecular formula C11H14ClN3O6S and a molecular weight of 351.76 g/mol. IUPAC name: (2S)-2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid. InChIKey: LHEYGVSDVBEYQF-QMMMGPOBSA-N.
| Molecular formula | C11H14ClN3O6S |
|---|---|
| Molecular weight | 351.76 g/mol |
| IUPAC name | (2S)-2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid |
| InChIKey | LHEYGVSDVBEYQF-QMMMGPOBSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)O)NC(=O)NC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)